You have no items in your shopping cart.
Cart summary
Fipronil desulfinyl
Catalog Number: orb2695734
| Catalog Number | orb2695734 |
|---|---|
| Category | Small Molecules |
| Description | Fipronil desulfinyl, a photodegradation product of the insecticide Fipronil, exhibits similar in vivo toxicity to Fipronil and possesses higher environmental toxicity. |
| CAS Number | 205650-65-3 |
| MW | 389.08 |
| SMILES | N#CC1=NN(C(N)=C1C(F)(F)F)C2=C(Cl)C=C(C=C2Cl)C(F)(F)F |
| Formula | C12H4Cl2F6N4 |
| Storage | -20°C |
| Note | For research use only |
| Expiration Date | 12 months from date of receipt. |
