You have no items in your shopping cart.
Cart summary
(-)-Eseroline fumarate
Catalog Number: orb1983349
| Catalog Number | orb1983349 |
|---|---|
| Category | Small Molecules |
| Description | (-)-Eseroline fumarate, a metabolite of the acetylcholinesterase inhibitor Physostigmine, promotes lactic acid dehydrogenase (LDH) leakage from cancer cells and triggers adenine nucleotides and 5-hydroxytryptamine (5-HT) release from neuronal cells, leading to cell death. Additionally, it suppresses electrically evoked muscle contractions in the mouse vas deferens and the guinea-pig ileum. |
| CAS Number | 70310-73-5 |
| Purity | 98.00% |
| MW | 334.37 |
| SMILES | OC(=O)\C=C\C(O)=O.[H][C@]12N(C)CC[C@@]1(C)c1cc(O)ccc1N2C |
| Formula | C17H22N2O5 |
| Biological Activity | (-)-Eseroline fumarate, a metabolite of the acetylcholinesterase inhibitor Physostigmine, promotes lactic acid dehydrogenase (LDH) leakage from cancer cells and triggers adenine nucleotides and 5-hydroxytryptamine (5-HT) release from neuronal cells, leading to cell death. Additionally, it suppresses electrically evoked muscle contractions in the mouse vas deferens and the guinea-pig ileum. |
| Storage | -20°C |
| Note | For research use only |
| Expiration Date | 12 months from date of receipt. |
