You have no items in your shopping cart.
You have no items in your shopping cart.
Catalog Number | orb1299136 |
---|---|
Category | Small Molecules |
Description | Ergothioneine |
Purity | 99.67% |
MW | 229.3 |
Biological Activity | Ergothioneine (L-(+)-Ergothioneine) is synthesized by certain bacteria and fungi. It is generally considered an antioxidant. |
CAS Number | [497-30-3] |
Formula | C9H15N3O2S |
SMILES | [C@@H](CC=1NC(=S)NC1)([N@@+](C)(C)C)C([O-])=O |
Storage | -20°C |
Note | For research use only |
WB | |
Human, Mouse, Rat | |
Rabbit | |
Polyclonal | |
Unconjugated |
IF, IHC-Fr, IHC-P | |
Rat | |
Mouse | |
Rabbit | |
Polyclonal | |
Unconjugated |
Human | |
78.13-5000 pg/mL | |
28 pg/mL |