You have no items in your shopping cart.
Cart summary
Eperisone hydrochloride
Catalog Number: orb1302230
| Catalog Number | orb1302230 |
|---|---|
| Category | Small Molecules |
| Description | Eperisone hydrochloride |
| CAS Number | 56839-43-1 |
| Purity | 99.95% |
| MW | 295.85 |
| SMILES | Cl.CCc1ccc(cc1)C(=O)C(C)CN1CCCCC1 |
| Formula | C17H26ClNO |
| Biological Activity | Eperisone is a skeletal muscle relaxant and a spasmolytic agent related structurally to Tolperisone. |
| Storage | -20°C |
| Note | For research use only |
| Expiration Date | 12 months from date of receipt. |
