You have no items in your shopping cart.
You have no items in your shopping cart.
Catalog Number | orb2277099 |
---|---|
Category | Small Molecules |
Description | EP2, an antimicrobial peptide with both antibacterial and antifungal properties, exhibits inhibitory effects against E. gallinarum, P. pyocyanea, A. baumanii, and K. terrigena, displaying a minimum inhibitory concentration (MIC) value of 11.4 μg/mL [1]. |
CAS Number | 749252-78-6 |
Purity | 98.00% |
MW | 535.61 |
SMILES | [C@H](C(N[C@H](C(N[C@H](C(N[C@H](C(O)=O)CO)=O)CO)=O)C(C)C)=O)(NC([C@@H](NC(C)=O)C)=O)CCSC |
Formula | C21H37N5O9S |
Biological Activity | EP2, an antimicrobial peptide with both antibacterial and antifungal properties, exhibits inhibitory effects against E. gallinarum, P. pyocyanea, A. baumanii, and K. terrigena, displaying a minimum inhibitory concentration (MIC) value of 11.4 μg/mL [1]. |
Storage | -20°C |
Note | For research use only |
Expiration Date | 12 months from date of receipt. |
WB | |
Bovine, Human, Rat | |
Mouse | |
Monoclonal | |
Unconjugated |
IF, IH, WB | |
Human, Mouse | |
Rabbit | |
Polyclonal | |
Unconjugated |
IF, IH, WB | |
Human, Mouse, Rat | |
Rabbit | |
Polyclonal | |
Unconjugated |