You have no items in your shopping cart.
You have no items in your shopping cart.
Catalog Number | orb1980200 |
---|---|
Category | Small Molecules |
Description | Ebalzotan (NAE 086) is a 5-HT1A receptor agonist that can be used to study depression. |
Purity | 99.41% |
MW | 318.45 |
Biological Activity | Ebalzotan (NAE 086) is a 5-HT1A receptor agonist that can be used to study depression. |
CAS Number | 149494-37-1 |
Formula | C19H30N2O2 |
SMILES | C(NC(C)C)(=O)C1=C2C(OC[C@H](N(CCC)C(C)C)C2)=CC=C1 |
Storage | -20°C |
Note | For research use only |
99.88% | |
294843-95-1 | |
318.45 | |
C19H30N2O2 |