You have no items in your shopping cart.
You have no items in your shopping cart.
Catalog Number | orb1304666 |
---|---|
Category | Small Molecules |
Description | (E)-Ethyl p-methoxycinnamate |
Purity | 97.56% |
MW | 206.24 |
Biological Activity | 1. (E)-Ethyl p-methoxycinnamate (EPMC) is an anticarcinogenic agent. 2. (E)-Ethyl p-methoxycinnamate (EPMC) is a glutathion S tranferase inhibitor. |
CAS Number | [24393-56-4] |
Formula | C12H14O3 |
SMILES | CCOC(=O)\C=C\C1=CC=C(OC)C=C1 |
Storage | -20°C |
Note | For research use only |