You have no items in your shopping cart.
You have no items in your shopping cart.
Catalog Number | orb2815834 |
---|---|
Category | Small Molecules |
Description | DT2216 inhibits various Bcl-XL-dependent leukemias and cancer cells, but is significantly less toxic to platelets.DT2216 is a selective B-cell lymphoma, extremely large (BCL-XL), proteolytic targeting chimera (PROTAC).DT2216 targets bcl-XL to the Von Hippel-Lindau (VHL) E3 ligase for degradation. |
MW | 1542.36 |
CAS Number | 2365172-42-3 |
Formula | C77H96ClF3N10O10S4 |
SMILES | CC1(C)CCC(C2=CC=C(Cl)C=C2)=C(C1)CN3CCN(C4=CC=C(C(NS(=O)(C5=CC(S(C(F)(F)F)(=O)=O)=C(N[C@@H](CSC6=CC=CC=C6)CCN7CCN(C(CCCCCC(N[C@@H](C(C)(C)C)C(N8[C@@H](C[C@@H](O)C8)C(N[C@H](C9=CC=C(C%10=C(N=CS%10)C)C=C9)C)=O)=O)=O)=O)CC7)C=C5)=O)=O)C=C4)CC3 |
Storage | -20°C |
Note | For research use only |