You have no items in your shopping cart.
You have no items in your shopping cart.
Catalog Number | orb1298742 |
---|---|
Category | Small Molecules |
Description | DOPEXAMINE |
Purity | 99.42% |
MW | 356.5 |
Biological Activity | Dopexamine is a dopaminergic agonist |
CAS Number | 86197-47-9 |
Formula | C22H32N2O2 |
SMILES | C(CNCCCCCCNCCC1=CC=CC=C1)C2=CC(O)=C(O)C=C2 |
Storage | -20°C |
Note | For research use only |
> 98% (HPLC) | |
86197-47-9 | |
356.5 | |
C22H32N2O2 |
> 98% (HPLC) | |
86484-91-5 | |
429.4 | |
C22H34Cl2N2O2 |
99.77% | |
86484-91-5 | |
429.42 | |
C22H34Cl2N2O2 |