You have no items in your shopping cart.
You have no items in your shopping cart.
Catalog Number | orb1309752 |
---|---|
Category | Small Molecules |
Description | Dofequidar fumarate |
CAS Number | 153653-30-6 |
Purity | 99.43% |
MW | 597.66 |
SMILES | OC(=O)\C=C\C(O)=O.OC(COc1cccc2ncccc12)CN1CCN(CC1)C(=O)C(c1ccccc1)c1ccccc1 |
Formula | C34H35N3O7 |
Biological Activity | Dofequidar fumarate (MS-209)(MS-209 fumarate), a quinoline-based compound administered orally, is known for counteracting multidrug resistance (MDR) through the inhibition of ABCB1/P-glycoprotein (P-gp) and ABCC1/MDR-associated protein 1. |
Storage | -20°C |
Note | For research use only |
Expiration Date | 12 months from date of receipt. |