You have no items in your shopping cart.
You have no items in your shopping cart.
Catalog Number | orb1983102 |
---|---|
Category | Small Molecules |
Description | Dlin-MeOH is a lipid membrane and a potential nucleic acid carrier for the synthesis of DLin-MC3-DMA. |
Purity | 99.95% |
MW | 528.94 |
Biological Activity | Dlin-MeOH is a lipid membrane and a potential nucleic acid carrier for the synthesis of DLin-MC3-DMA. |
CAS Number | [1169768-28-8] |
Formula | C37H68O |
SMILES | C(C(CCCCCCCC/C=C\C/C=C\CCCCC)O)CCCCCCC/C=C\C/C=C\CCCCC |
Storage | -20°C |
Note | For research use only |
Expiration Date | 12 months from date of receipt. |