You have no items in your shopping cart.
You have no items in your shopping cart.
Catalog Number | orb2802428 |
---|---|
Category | Small Molecules |
Description | Defactinib analogue-1 (Compound 7) serves as a ligand for the target protein FAK, and is utilized in the synthesis of PROTAC FAK degrader 1. |
MW | 467.47 |
CAS Number | 2296719-34-9 |
Formula | C20H20F3N5O3S |
SMILES | O=S(=O)(N(C1=CC=CC(=C1)CNC2=NC(=NC=C2C(F)(F)F)NC3=CC=C(O)C=C3)C)C |
Storage | -20°C |
Note | For research use only |