You have no items in your shopping cart.
You have no items in your shopping cart.
Catalog Number | orb1303393 |
---|---|
Category | Small Molecules |
Description | Decursin |
Purity | 97.22% |
MW | 328.36 |
Biological Activity | 1. Decursin (Decursinol angelate) is able to attenuate kainic acid-induced seizures and could have potential as an antiepileptic drug. 2. Decursin exhibits hepatoprotective effects , potentially by inhibiting the TGF-β1 induced NOX activation and Smad signaling. 3. Decursin has anti-cancer activity , mediated suppression of the PKCα, MAPK and NF-κB pathways in MCF-7 cells. 4. Decursin exhibits cytotoxicity against various human cancer cells and to possess anti-amnesic activity in vivo through the inhibition of AChE activity. |
CAS Number | [5928-25-6] |
Formula | C19H20O5 |
SMILES | CC(C)=CC(=O)O[C@H]1Cc2cc3ccc(=O)oc3cc2OC1(C)C |
Storage | -20°C |
Note | For research use only |
> 98% (HPLC) | |
5928-25-6 | |
328.4 | |
C19H20O5 |