You have no items in your shopping cart.
Cart summary
Decursin
Catalog Number: orb1303393
| Catalog Number | orb1303393 |
|---|---|
| Category | Small Molecules |
| Description | Decursin |
| Purity | 97.22% |
| MW | 328.36 |
| Biological Activity | 1. Decursin (Decursinol angelate) is able to attenuate kainic acid-induced seizures and could have potential as an antiepileptic drug. 2. Decursin exhibits hepatoprotective effects , potentially by inhibiting the TGF-β1 induced NOX activation and Smad signaling. 3. Decursin has anti-cancer activity , mediated suppression of the PKCα, MAPK and NF-κB pathways in MCF-7 cells. 4. Decursin exhibits cytotoxicity against various human cancer cells and to possess anti-amnesic activity in vivo through the inhibition of AChE activity. |
| CAS Number | [5928-25-6] |
| Formula | C19H20O5 |
| SMILES | CC(C)=CC(=O)O[C@H]1Cc2cc3ccc(=O)oc3cc2OC1(C)C |
| Storage | -20°C |
| Note | For research use only |
Decursin [orb1221994]
> 98% (HPLC)
5928-25-6
328.4
C19H20O5
1 g, 100 mg, 500 mg, 5 mg, 10 mg, 25 mg, 50 mg
