You have no items in your shopping cart.
You have no items in your shopping cart.
Catalog Number | orb532406 |
---|---|
Category | Small Molecules |
Description | Abs/Em = 646/661 nm |
Form/Appearance | powder; Color: blue |
Purity | ≥ 90% (HPLC) |
MW | Theoretical MW: 1009.22 g/mol (free acid); Detected MW: 1008.31 g/mol (free acid) |
Application notes | < b>Spectroscopic Propertie: λabs 646 nm, λem 661 nm, ε 251.0 L mmol-1 cm-1. |
Solubility (25°C) | DMF, DMSO, water |
CAS Number | 1564286-24-3 (inner salt) |
Formula | C52H56N4O11S3 |
SMILES | O=C(CCNC(=O)CCCCC[N+]1=C(C(c2cc(ccc12)S(=O)(=O)[O-])(C)C)/C=C/C=C/C=C/1\C(c2cc(ccc2N1CCCS(=O)(=O)O)S(=O)(=O)O)(C)C)N1Cc2ccccc2C#Cc2c1cccc2 |
Storage | store at -20 °C |
Note | For research use only |
≥ 90% (HPLC) | |
1564286-24-3 (inner salt) | |
Theoretical MW: 1009.22 g/mol (free acid); Detected MW: 1008.31 g/mol (free acid) | |
C52H56N4O11S3 |
≥ 90% (HPLC) | |
1564286-24-3 (inner salt) | |
Theoretical MW: 1009.22 g/mol (free acid); Detected MW: 1008.31 g/mol (free acid) | |
C52H56N4O11S3 |