You have no items in your shopping cart.
You have no items in your shopping cart.
Catalog Number | orb2646551 |
---|---|
Category | Small Molecules |
Description | 100 mM Sodium salt solution |
CAS Number | 1927-31-7 |
SMILES | O[C@@H]1[C@@H](COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O[C@@H](n2cnc3c(N)ncnc23)C1 |
Storage | store at -20 °C |
Note | For research use only |
≥ 99% (HPLC) | |
1927-31-7 | |
Theoretical MW: 491.18 g/mol (free acid) | |
C10H16N5O12P3 |
≥ 99% (HPLC) | |
1927-31-7 | |
Theoretical MW: 491.18 g/mol (free acid) | |
C10H16N5O12P3 |