You have no items in your shopping cart.
Cart summary
Daphnelantoxin B
Catalog Number: orb1990870
| Catalog Number | orb1990870 |
|---|---|
| Category | Small Molecules |
| Description | Daphnelantoxin B |
| Purity | 98.00% |
| MW | 236.314 |
| SMILES | O=C(\C=C\CCc1ccccc1)c1ccccc1 |
| Formula | C17H16O |
| Biological Activity | Daphnelantoxin B is a useful organic compound for research related to life sciences and the catalog number is orb1990870. |
| Storage | -20°C |
| Note | For research use only |
| Expiration Date | 12 months from date of receipt. |
