You have no items in your shopping cart.
You have no items in your shopping cart.
Catalog Number | orb533282 |
---|---|
Category | Small Molecules |
Description | (c-di-AMP) |
Form/Appearance | solid; Color: white to off-white |
Purity | ≥ 98% (HPLC) |
MW | Theoretical MW: 658.41 g/mol (free acid); Detected MW: 658.11 g/mol (free acid) |
Application notes | < b>Spectroscopic Propertie: λmax 259 nm, ε 27.0 L mmol-1 cm-1 (Tris-HCl, pH 7.5). |
CAS Number | 54447-84-6 |
Formula | C20H24N10O12P |
SMILES | Nc1c2c(n(cn2)[C@@H]2O[C@@H]3COP(=O)(O[C@@H]4[C@@H](COP(=O)(O[C@H]3[C@H]2O)O)O[C@@H](n2c3c(nc2)c(N)ncn3)[C@@H]4O)O)ncn1 |
Storage | store at -20 °C |
Note | For research use only |
Greater than 85% as determined by SDS-PAGE. | |
45.9 kDa | |
E.coli |
≥ 98% (HPLC) | |
54447-84-6 | |
Theoretical MW: 658.41 g/mol (free acid); Detected MW: 658.11 g/mol (free acid) | |
C20H24N10O12P |
98.00% | |
45.9 kDa (predicted) |