You have no items in your shopping cart.
You have no items in your shopping cart.
Catalog Number | orb532298 |
---|---|
Category | Small Molecules |
Description | Abs/Em = 646/662 nm |
Form/Appearance | powder; Color: blue |
Purity | ≥ 90% (HPLC) |
MW | Theoretical MW: 565.78 g/mol (free cation); Detected MW: 565.36 g/mol (free cation) |
Application notes | < b>Spectroscopic Propertie: λabs 646 nm, λem 662 nm, ε 250.0 L mmol-1 cm-1 (after click reaction). |
Solubility (25°C) | soluble in DMSO, DMF, Dichlormethan, insoluble in water |
Formula | C35H45N6O |
SMILES | C\1(=C/C=C/C=C/C2=[N+](c3ccccc3C2(C)C)CCCCCC(=O)NCCCN=[N+]=[N-])/C(c2c(N1C)cccc2)(C)C |
Storage | store at -20 °C |
Note | For research use only |
≥ 90% (HPLC) | |
Theoretical MW: 565.78 g/mol (free cation); Detected MW: 565.36 g/mol (free cation) | |
C35H45N6O |
≥ 90% (HPLC) | |
1782950-80-4 | |
Theoretical MW: 833.01 g/mol (free acid); Detected MW: 832.26 g/mol (free acid) | |
C37H48N6O10S3 |
≥ 90% (HPLC) | |
1782950-80-4 | |
Theoretical MW: 833.01 g/mol (free acid); Detected MW: 832.26 g/mol (free acid) | |
C37H48N6O10S3 |
≥ 90% (HPLC) | |
1782950-80-4 | |
Theoretical MW: 833.01 g/mol (free acid); Detected MW: 832.26 g/mol (free acid) | |
C37H48N6O10S3 |