You have no items in your shopping cart.
You have no items in your shopping cart.
Catalog Number | orb321021 |
---|---|
Category | Tools |
Description | CTX IV (6-12) |
Purity | ≥98% |
MW | 899.14 |
Solubility (25°C) | Slightly soluble in water. |
Formula | C48H70N10O7 |
SMILES | CC[C@H](C)[C@@H](C(=O)N1CCC[C@H]1C(=O)N2CCC[C@H]2C(=O)N[C@@H](Cc3ccccc3)C(=O)N[C@@H](Cc4c[nH]c5c4cccc5)C(=O)N[C@@H](CCCCN)C(=O)N)NC(=O)[C@H](CC(C)C)N |
Storage | Storage Temp: -20°C |
Note | For research use only |
98.00% | |
115722-23-1 | |
899.13 | |
C48H70N10O7 |
100.00% | |
2918768-05-3 | |
1013.16 | |
C50H71F3N10O9 |