You have no items in your shopping cart.
You have no items in your shopping cart.
Catalog Number | orb1984118 |
---|---|
Category | Small Molecules |
Description | Cnidimol B is a natural product. |
Purity | 98.00% |
MW | 292.28 |
Biological Activity | Cnidimol B is a natural product. |
CAS Number | [103629-81-8] |
Formula | C15H16O6 |
SMILES | O=C1C=C(OC=2C=C3OC(CC3=C(O)C12)C(O)(C)CO)C |
Storage | -20°C |
Note | For research use only |