You have no items in your shopping cart.
Cart summary
Cerberic acid
Catalog Number: orb1992171
| Catalog Number | orb1992171 |
|---|---|
| Category | Small Molecules |
| Description | Cerberic acid |
| Purity | 98.00% |
| MW | 220.18 |
| Biological Activity | Cerberic acid is a useful organic compound for research related to life sciences and the catalog number is orb1992171. |
| Formula | C11H8O5 |
| SMILES | COC(=O)c1cocc2c(ccc12)C(O)=O |
| Storage | -20°C |
| Note | For research use only |
