You have no items in your shopping cart.
Cart summary
BODIPY-FL
Catalog Number: orb1745229
| Catalog Number | orb1745229 |
|---|---|
| Category | Small Molecules |
| Description | BODIPY-FL (BDP FL acid) is a broad-spectrum and effective fluorescent dye that can be used to label probes or primers and is a compound for the quantitative detection of specific DNA/RNA based on fluorescence bursts.BODIPY-FL-labelled monoterpenes can be used to detect Gram-positive and Gram-negative bacteria as characteristic and pathogenic fungi. |
| CAS Number | 165599-63-3 |
| Purity | 99.05% |
| MW | 292.09 |
| SMILES | CC1=CC(C)=[N+]2C1=Cc1ccc(CCC(O)=O)n1[B-]2(F)F |
| Formula | C14H15BF2N2O2 |
| Biological Activity | BODIPY-FL (BDP FL acid) is a broad-spectrum and effective fluorescent dye that can be used to label probes or primers and is a compound for the quantitative detection of specific DNA/RNA based on fluorescence bursts.BODIPY-FL-labelled monoterpenes can be used to detect Gram-positive and Gram-negative bacteria as characteristic and pathogenic fungi. |
| Storage | -20°C |
| Note | For research use only |
| Expiration Date | 12 months from date of receipt. |
