You have no items in your shopping cart.
You have no items in your shopping cart.
Catalog Number | orb1909487 |
---|---|
Category | Small Molecules |
Description | Bis-propargyl-PEG5 serves as a PEG-based PROTAC linker, facilitating the synthesis of PROTACs. This chemical compound is particularly employed in the synthesis of carbohydrate receptors (SCRs) with anti-Zika activity[1]. |
Purity | 98.00% |
MW | 314.37 |
Biological Activity | Bis-propargyl-PEG5 serves as a PEG-based PROTAC linker, facilitating the synthesis of PROTACs. This chemical compound is particularly employed in the synthesis of carbohydrate receptors (SCRs) with anti-Zika activity[1]. |
CAS Number | 185378-83-0 |
Formula | C16H26O6 |
SMILES | C(COCCOCCOCC#C)OCCOCCOCC#C |
Storage | -20°C |
Note | For research use only |