You have no items in your shopping cart.
You have no items in your shopping cart.
Catalog Number | orb1301329 |
---|---|
Category | Small Molecules |
Description | Bergamottin |
CAS Number | 7380-40-7 |
Purity | 99.99% |
MW | 338.4 |
SMILES | CC(C)=CCC\C(C)=C\COc1c2ccoc2cc2oc(=O)ccc12 |
Formula | C21H22O4 |
Biological Activity | 1. Bergamottin (5-Geranoxypsoralen) can significantly reduce blood glucose and increase glucose tolerance and insulin sensitivity in KK-Aydiabetic mice. |
Storage | -20°C |
Note | For research use only |
Expiration Date | 12 months from date of receipt. |