You have no items in your shopping cart.
You have no items in your shopping cart.
Catalog Number | orb1302342 |
---|---|
Category | Small Molecules |
Description | Berberrubine chloride |
Purity | 99.11% |
MW | 357.79 |
Biological Activity | 1. Berberrubine chloride (9-Berberoline Chloride) has antitumor activity. 2. Berberrubine has antidiabetic activity. 3. Berberrubine dose-dependently inhibits IL-8 and MCP-1 protein levels in the media and mRNA expression of the cells stimulated with IL-1beta or TNF-alpha. |
CAS Number | [15401-69-1] |
Formula | C19H16ClNO4 |
SMILES | [Cl-].COc1ccc2cc3-c4cc5OCOc5cc4CC[n+]3cc2c1O |
Storage | -20°C |
Note | For research use only |