You have no items in your shopping cart.
You have no items in your shopping cart.
Catalog Number | orb2299802 |
---|---|
Category | Small Molecules |
Description | Beclomethasone Dipropionate-d6 is a deuterated compound of Beclomethasone Dipropionate. Beclomethasone Dipropionate has a CAS number of 5534-09-8. Beclomethasone Dipropionate is the dipropionate ester of a synthetic glucocorticoid with anti-inflammatory and immunomodulating properties. After cell surface receptor attachment and cell entry, beclomethasone enters the nucleus where it binds to and activates specific nuclear receptors, resulting in an altered gene expression and inhibition of proinflammatory cytokine production. |
Purity | 98.00% |
MW | 527.08 |
Biological Activity | Beclomethasone Dipropionate-d6 is a deuterated compound of Beclomethasone Dipropionate. Beclomethasone Dipropionate has a CAS number of 5534-09-8. Beclomethasone Dipropionate is the dipropionate ester of a synthetic glucocorticoid with anti-inflammatory and immunomodulating properties. After cell surface receptor attachment and cell entry, beclomethasone enters the nucleus where it binds to and activates specific nuclear receptors, resulting in an altered gene expression and inhibition of proinflammatory cytokine production. |
Formula | C28H31D6ClO7 |
SMILES | O=C1C=C[C@]2(C(=C1)CC[C@@]1([C@@]2([C@H](C[C@]2([C@]1(C[C@@H]([C@@]2(C(COC(=O)CC([2H])([2H])[2H])=O)OC(=O)CC([2H])([2H])[2H])C)[H])C)O)Cl)[H])C |
Storage | -20°C |
Note | For research use only |