You have no items in your shopping cart.
You have no items in your shopping cart.
Catalog Number | orb1710309 |
---|---|
Category | Small Molecules |
Description | Bay 41-4109 |
CAS Number | 298708-81-3 |
Purity | 98.00% |
MW | 395.76 |
SMILES | COC(=O)C1=C(C)N=C(N[C@H]1c1ccc(F)cc1Cl)c1ncc(F)cc1F |
Formula | C18H13ClF3N3O2 |
Biological Activity | BAY 41-4109 is a potent inhibitor of human hepatitis B virus (HBV)(IC50 : 53 nM). |
Storage | -20°C |
Note | For research use only |
Expiration Date | 12 months from date of receipt. |
98.48% | |
298708-79-9 | |
395.76 | |
C18H13ClF3N3O2 |
98% | |
476617-51-3 | |
395.76 | |
C18H13ClF3N3O2 |
[298708-79-9] | |
395.766 | |
C18H13ClF3N3O2 |
[476617-51-3] | |
395.76 | |
C18H13ClF3N3O2 |