You have no items in your shopping cart.
Cart summary
Aurantio-obtusin
Catalog Number: orb1300205
| Catalog Number | orb1300205 |
|---|---|
| Category | Small Molecules |
| Description | Aurantio-obtusin |
| Purity | 99.45% |
| MW | 330.29 |
| Biological Activity | 1. Biotransformation of glucoAurantio-obtusin towards Aurantio-obtusin increased the toxicity of irinotecan through increased inhibition of SN-38 glucuronidation. 2. Aurantio-obtusin, stimulated chemotactic migration of MC3T3-E1 osteoblast cells in a concentration-dependent manner. Besides migration, the compound stimulated osteoblast differentiation and mineralization. 3. Aurantio-obtusin is a promising osteoanabolic compound of natural origin with potential therapeutic applications in the prevention of osteoporosis and other metabolic bone diseases. |
| CAS Number | [67979-25-3] |
| Formula | C17H14O7 |
| SMILES | COc1c(O)cc2C(=O)c3cc(C)c(O)c(OC)c3C(=O)c2c1O |
| Storage | -20°C |
| Note | For research use only |
Aurantio-obtusin [orb1221888]
> 98% (HPLC)
67979-25-3
330.3
C17H14O7
1 g, 500 mg, 200 mg, 100 mg, 5 mg, 10 mg, 25 mgAurantio-obtusin β-D-glucoside [orb1297457]
99.17%
[129025-96-3]
492.43
C23H24O12
100 mg, 50 mg, 25 mg, 10 mg, 5 mg, 1 mg, 1 ml x 10 mM (in DMSO)
