You have no items in your shopping cart.
Cart summary
Arimoclomol maleate
Catalog Number: orb1308865
| Catalog Number | orb1308865 |
|---|---|
| Category | Small Molecules |
| Description | Arimoclomol maleate |
| CAS Number | 289893-26-1 |
| Purity | 99.90% |
| MW | 429.85 |
| SMILES | OC(=O)\C=C/C(O)=O.O[C@@H](CO\N=C(/Cl)c1ccc[n+]([O-])c1)CN1CCCCC1 |
| Formula | C18H24ClN3O7 |
| Biological Activity | Arimoclomol maleate (BRX-220) (BRX-220) is a heat shock protein (HSP) co-inducer. |
| Storage | -20°C |
| Note | For research use only |
| Expiration Date | 12 months from date of receipt. |
