You have no items in your shopping cart.
Cart summary
Arbidol-d6 Hydrochloride
Catalog Number: orb2300221
| Catalog Number | orb2300221 |
|---|---|
| Category | Small Molecules |
| Description | Arbidol-d6 Hydrochloride is a deuterated compound of Arbidol Hydrochloride. Arbidol Hydrochloride has a CAS number of 131707-23-8. Arbidol (Umifenovir) hydrochloride, an broad-spectrum antiviral chemical agent, can inhibit cell invade of enveloped viruses by blocking viral fusion with host cell membrane. |
| CAS Number | 2928218-29-3 |
| Purity | 98.00% |
| MW | 519.91 |
| SMILES | C(OCC)(=O)C=1C=2C(N(C)C1CSC3=CC=CC=C3)=CC(Br)=C(O)C2CN(C([2H])([2H])[2H])C([2H])([2H])[2H].Cl |
| Formula | C22H20D6BrClN2O3S |
| Biological Activity | Arbidol-d6 Hydrochloride is a deuterated compound of Arbidol Hydrochloride. Arbidol Hydrochloride has a CAS number of 131707-23-8. Arbidol (Umifenovir) hydrochloride, an broad-spectrum antiviral chemical agent, can inhibit cell invade of enveloped viruses by blocking viral fusion with host cell membrane. |
| Storage | -20°C |
| Note | For research use only |
| Expiration Date | 12 months from date of receipt. |
