You have no items in your shopping cart.
You have no items in your shopping cart.
Catalog Number | orb1982446 |
---|---|
Category | Small Molecules |
Description | Antibacterial Agent 123 (Compound 111) serves as an effective membrane-disrupting agent targeting antibiotic-resistant Gram-positive bacteria [1]. |
Purity | 98.00% |
MW | 441.25 |
Biological Activity | Antibacterial Agent 123 (Compound 111) serves as an effective membrane-disrupting agent targeting antibiotic-resistant Gram-positive bacteria [1]. |
CAS Number | 2615254-55-0 |
Formula | C17H8F9N3O |
SMILES | N(C1=C2C(=CC(C(F)(F)F)=C1)NC(C(F)(F)F)=CC2=O)C3=CC=C(C(F)(F)F)C=N3 |
Storage | -20°C |
Note | For research use only |