You have no items in your shopping cart.
You have no items in your shopping cart.
Catalog Number | orb2665566 |
---|---|
Category | Small Molecules |
Description | Aclidinium, a dual-action compound, serves as a long-acting muscarinic antagonist and a β2-adrenoceptor (β2-AR) agonist, exhibiting bronchodilator properties. It effectively reduces lung hyperinflation, enhances lung function, and prolongs exercise endurance time. This compound is commonly utilized in studies focusing on chronic obstructive pulmonary disease (COPD). |
Purity | 98.00% |
MW | 484.65 |
CAS Number | 727649-81-2 |
Formula | C26H30NO4S2 |
SMILES | C(CCOC1=CC=CC=C1)[N+]23C[C@H](OC(C(O)(C4=CC=CS4)C5=CC=CS5)=O)C(CC2)CC3 |
Storage | -20°C |
Note | For research use only |
> 98%(HPLC) | |
320345-99-1 | |
564.6 | |
C26H30NO4S2·Br |
98.93% | |
[320345-99-1] | |
564.55 | |
C26H30NO4S2·Br |