You have no items in your shopping cart.
Cart summary
Acid orange 7
Catalog Number: orb1299795
| Catalog Number | orb1299795 |
|---|---|
| Category | Small Molecules |
| Description | Acid orange 7 |
| Purity | 99.54% |
| MW | 350.32 |
| Biological Activity | Acid orange 7 (COLIPA C015) is a dye used to dye wool. |
| CAS Number | [633-96-5] |
| Formula | C16H11N2NaO4S |
| SMILES | O=S(=O)([O-])c1ccc(N=Nc2c(O)ccc3ccccc23)cc1.[Na+] |
| Storage | -20°C |
| Note | For research use only |
