You have no items in your shopping cart.
You have no items in your shopping cart.
Catalog Number | orb1684803 |
---|---|
Category | Small Molecules |
Description | 7-Xylosyl-10-deacetyltaxol B |
Purity | 98.00% |
MW | 921.98 |
Biological Activity | 7-Xylosyl-10-deacetyltaxol B (7-xylosyl-10-Deacetylpaclitaxel B) is a paclitaxel derivative from the Northeastern red bean tree (Picea abies) in the Sequoia family, with antitumor activity, and can be used for the synthesis of paclitaxel. |
CAS Number | [90332-64-2] |
Formula | C48H59NO17 |
SMILES | O(C(C)=O)[C@]12[C@@]3([C@@](C)([C@@H](O[C@H]4[C@H](O)[C@@H](O)[C@H](O)CO4)C[C@]1(OC2)[H])C(=O)[C@H](O)C=5C(C)(C)[C@](O)([C@H]3OC(=O)C6=CC=CC=C6)C[C@H](OC([C@@H]([C@@H](NC(/C(=C/C)/C)=O)C7=CC=CC=C7)O)=O)C5C)[H] |
Storage | -20°C |
Note | For research use only |