You have no items in your shopping cart.
You have no items in your shopping cart.
Catalog Number | orb2299481 |
---|---|
Category | Small Molecules |
Description | (±)-7-epiJasmonic acid, the primary metabolite in the 12-oxo phytodienoic acid pathway of 13(S)-hydroperoxy linolenic acid metabolism in plants, is synthesized initially as the more active (+)-7-epijasmonic acid. It quickly epimerizes to the more stable (−)-7-jasmonic acid isomer, demonstrating its biological relevance. Acting as a plant growth regulator, (±)-7-epiJasmonic acid triggers various signal transduction pathways, which can either promote growth or inhibit it, likely as a response to stress conditions. |
Purity | 98.00% |
MW | 210.273 |
Biological Activity | (±)-7-epiJasmonic acid, the primary metabolite in the 12-oxo phytodienoic acid pathway of 13(S)-hydroperoxy linolenic acid metabolism in plants, is synthesized initially as the more active (+)-7-epijasmonic acid. It quickly epimerizes to the more stable (−)-7-jasmonic acid isomer, demonstrating its biological relevance. Acting as a plant growth regulator, (±)-7-epiJasmonic acid triggers various signal transduction pathways, which can either promote growth or inhibit it, likely as a response to stress conditions. |
CAS Number | 62653-85-4 |
Formula | C12H18O3 |
SMILES | CC\C=C/C[C@H]1[C@@H](CC(O)=O)CCC1=O |
Storage | -20°C |
Note | For research use only |