You have no items in your shopping cart.
Cart summary
5-Hydroxy Saxagliptin-13C-d2 HCl
Catalog Number: orb2299882
| Catalog Number | orb2299882 |
|---|---|
| Category | Small Molecules |
| Description | 5-Hydroxy Saxagliptin-13C-d2 HCl the 13C and deuterated compound of 5-Hydroxy Saxagliptin HCl. 5-Hydroxy Saxagliptin HCl has a CAS number of 841302-24-7. |
| Purity | 98.00% |
| MW | 370.88 |
| SMILES | C12(O)CC3CC([C@H](N)[13C](N4[C@H](C#N)C[C@H]5[C@@H]4C5([2H])[2H])=O)(CC(O)(C3)C1)C2.Cl |
| Formula | 13CC17D2H24ClN3O3 |
| Biological Activity | 5-Hydroxy Saxagliptin-13C-d2 HCl the 13C and deuterated compound of 5-Hydroxy Saxagliptin HCl. 5-Hydroxy Saxagliptin HCl has a CAS number of 841302-24-7. |
| Storage | -20°C |
| Note | For research use only |
| Expiration Date | 12 months from date of receipt. |
