You have no items in your shopping cart.
Cart summary
4-Bromophenoxytetrafluorobromoethane
Catalog Number: orb2645501
| Catalog Number | orb2645501 |
|---|---|
| Category | Small Molecules |
| Description | 4-Bromophenoxytetrafluorobromoethane |
| Form/Appearance | Colorless to slightly yellowish liquid |
| MW | 351.92 |
| CAS Number | 113939-45-0 |
| Formula | C8H4Br2F4O |
| SMILES | FC(F)(C(F)(Br)F)OC1=CC=C(Br)C=C1 |
| Storage | Storage/Stability: rt. Handling Conditions: avoid exposure to light |
| Note | For research use only |
