You have no items in your shopping cart.
Cart summary
| Catalog Number | orb65073 |
|---|---|
| Category | Tools |
| Description | (S)-2-Amino-3-azidopropanoic acid hydrochloride |
| CAS Number | 105661-40-3 |
| Form/Appearance | powder; Color: white |
| Purity | mass identification conforms (ESI-MS) |
| MW | Theoretical MW: 130.11 g/mol; Detected MW: 130.05 g/mol |
| SMILES | OC(=O)[C@H](CN=[N+]=[N-])N |
| Formula | C3H6N4O2 |
| Hazard Information | Non-Toxic |
| Storage | store at 4 °C |
| Note | For research use only |
| Expiration Date | 12 months from date of receipt. |
3-Azido-L-alanine HCl
