You have no items in your shopping cart.
You have no items in your shopping cart.
Catalog Number | orb65074 |
---|---|
Category | Small Molecules |
Description | (R)-2-Amino-3-azidopropanoic acid hydrochloride |
Form/Appearance | powder; Color: white |
Purity | mass identification conforms (ESI-MS) |
MW | Theoretical MW: 130.11 g/mol; Detected MW: 130.05 g/mol |
CAS Number | 105928-88-9 |
Formula | C3H6N4O2 |
SMILES | OC(=O)[C@@H](CN=[N+]=[N-])N |
Storage | store at 4 °C |
Note | For research use only |
mass identification conforms (ESI-MS) | |
105928-88-9 | |
Theoretical MW: 130.11 g/mol; Detected MW: 130.05 g/mol | |
C3H6N4O2 |
mass identification conforms (ESI-MS) | |
105928-88-9 | |
Theoretical MW: 130.11 g/mol; Detected MW: 130.05 g/mol | |
C3H6N4O2 |