You have no items in your shopping cart.
You have no items in your shopping cart.
Catalog Number | orb1303698 |
---|---|
Category | Small Molecules |
Description | 2'-Deoxy-2'-fluorouridine |
Purity | 99.81% |
MW | 246.19 |
Biological Activity | 2'-Deoxy-2'-fluorouridine serves as an intermediate in the synthesis of antiviral agents targeting influenza viruses[1]. |
CAS Number | 784-71-4 |
Formula | C9H11FN2O5 |
SMILES | OC[C@H]1O[C@H]([C@H](F)[C@@H]1O)n1ccc(=O)[nH]c1=O |
Storage | -20°C |
Note | For research use only |
98.00% | |
512.55 | |
C21H42FN4O7P |
98.00% | |
1445379-59-8 | |
360.45 | |
C15H25FN2O5Si |
98.00% |