Ion Channel Modulators

Ion channels are proteins that span the cell membrane and control the flow of ions such as sodium, potassium, and calcium into and out of the cell. The activity of ion channels is essential for many cellular processes, such as muscle contraction, nerve impulse conduction, and hormone secretion. Ion channel modulators are small molecules that interact with specific ion channels.

Items 1-10 of 37

Page
per page
  1. VX661 [orb181347]

    [1152311-62-0]

    520.5

    C26H27F3N2O6

    C(C1=CC=C2OC(F)(F)OC2=C1)(C(NC1C(F)=CC2=C(C=1)C=C(C(C)(C)CO)N2C[C@H](O)CO)=O)1CC1

    100 mg, 250 mg, 1000 mg
  2. Sodium-Channel-inhibitor-1 [orb181326]

    [1198117-23-5]

    473.42

    C24H19F4N3O3

    O=C(C1N(CCC2=NC=CC=C2)C(C3=C1C(F)=CC=C3)=O)NCC4=CC=C(OC(F)(F)F)C=C4

    100 mg, 250 mg, 1000 mg
  3. PPQ-102 [orb181305]

    [931706-15-9]

    438.48

    C26H22N4O3

    C12N3C(C4=CC=CC=C4)=C4C(=O)N(C)C(=O)N(C)C4=C3C(C3=CC=C(C)O3)NC=1C=CC=C2

    100 mg, 250 mg, 1000 mg
  4. Mibefradil-dihydrochloride [orb181288]

    [116666-63-8]

    568.55

    C29H40Cl2FN3O3

    100 mg, 250 mg, 1000 mg
  5. KU14R [orb181273]

    [189224-48-4]

    214.26

    C13H14N2O

    CCC1(C2=NC=CN2)OC3=CC=CC=C3C1

    100 mg, 250 mg, 1000 mg
  6. TAK-438 [orb181155]

    [1260141-27-2]

    461.46

    C17H16FN3O2S.C4H4O4

    N(S(C1=CC=CN=C1)(=O)=O)1C(C2=CC=CC=C2F)=CC(CNC)=C1.C(O)(=O)/C=C/C(O)=O

    100 mg, 250 mg, 1000 mg
  7. Ralfinamide [orb181142]

    [202825-45-4]

    398.44902

    C17H19N2O2F.CH4O3S

    C[C@H](NCC1=CC=C(OCC2=CC=CC=C2F)C=C1)C(N)=O.CS(=O)(O)=O

    100 mg, 250 mg, 1 g
  8. Rufinamide [orb181120]

    [106308-44-5]

    238.1935

    C10H8F2N4O

    NC(=O)C1=CN(N=N1)CC2=C(F)C=CC=C2F

    100 mg, 250 mg, 1000 mg
  9. ICILIN [orb181068]

    [36945-98-9]

    311.2921

    C16H13N3O4

    O=C1N([H])C(C2C([H])=C([H])C([H])=C(C=2[H])[N+](=O)[O-])=C([H])C([H])([H])N1C1=C([H])C([H])=C([H])C([H])=C1O[H]

    100 mg, 250 mg, 1000 mg
  10. IOWH-032 [orb181036]

    [1191252-49-9]

    545.18

    C22H15Br2N3O4

    BrC1=C(O)C(Br)=CC(C2=NOC(C(NCC3=CC=C(OC4=CC=CC=C4)C=C3)=O)=N2)=C1

    100 mg, 250 mg, 1000 mg

Items 1-10 of 37

Page
per page