You have no items in your shopping cart.
You have no items in your shopping cart.
Catalog Number | orb1307013 |
---|---|
Category | Small Molecules |
Description | N6,N6-Dimethyladenosine |
Purity | 99.42% |
MW | 295.29 |
Biological Activity | N6,N6-Dimethyladenosine is find in mycobacterium bovis Bacille Calmette-Guérin tRNA. |
CAS Number | [2620-62-4] |
Formula | C12H17N5O4 |
SMILES | CN(C)c1ncnc2n(cnc12)[C@@H]1O[C@H](CO)[C@@H](O)[C@H]1O |
Storage | -20°C |
Note | For research use only |
98.00% | |
13406-53-6 | |
329.74 | |
C12H16ClN5O4 |
98.00% | |
2305415-86-3 | |
338.36 | |
C14H22N6O4 |
98.00% | |
1336975-57-5 | |
324.34 | |
C13H20N6O4 |
98.00% | |
565450-82-0 | |
319.32 | |
C14H17N5O4 |
98.00% | |
384334-64-9 | |
320.31 | |
C12H16N8O3 |