You have no items in your shopping cart.
You have no items in your shopping cart.
Catalog Number | orb1308454 |
---|---|
Category | Small Molecules |
Description | Chroman 1 |
Purity | 99.28% |
MW | 436.5 |
Biological Activity | Chroman 1 is a potent inhibitor of ROCK1 (IC50 = 52 pM) and ROCK2 (IC50 = 1 pM). |
CAS Number | [1273579-40-0] |
Formula | C24H28N4O4 |
SMILES | COc1ccc2OC[C@H](Cc2c1)C(=O)Nc1ccc(cc1OCCN(C)C)-c1cn[nH]c1 |
Storage | -20°C |
Note | For research use only |
100.00% | |
182570-28-1 | |
208.21 | |
C11H12O4 |
98.00% | |
[204935-85-3] | |
370.4 | |
C21H22O6 |