You have no items in your shopping cart.
You have no items in your shopping cart.
Catalog Number | orb1308892 |
---|---|
Category | Small Molecules |
Description | 2'-O-Methyladenosine |
Purity | 99.76% |
MW | 281.27 |
Biological Activity | 2'-O-Methyladenosine, a methylated adenine residue is found in the urine of normals and adenosine deaminase deficient patients. It shows unique hypotensive activities. |
CAS Number | 2140-79-6 |
Formula | C11H15N5O4 |
SMILES | CO[C@@H]1[C@H](O)[C@@H](CO)O[C@H]1n1cnc2c(N)ncnc12 |
Storage | -20°C |
Note | For research use only |
IP, WB | |
Human, Mouse | |
Rabbit | |
Polyclonal | |
Unconjugated |
Greater than 85% as determined by SDS-PAGE. | |
65.7 kDa | |
E.coli |
Greater than 85% as determined by SDS-PAGE. | |
61.5 kDa | |
E.coli |