You have no items in your shopping cart.
You have no items in your shopping cart.
Catalog Number | orb1706358 |
---|---|
Category | Small Molecules |
Description | Hoechst 33258 analog 5 |
CAS Number | 23491-55-6 |
Purity | 98% |
MW | 458.56 |
SMILES | CN1CCN(CC1)c1ccc2nc([nH]c2c1)-c1ccc2nc([nH]c2c1)-c1ccc2ccccc2c1 |
Formula | C29H26N6 |
Biological Activity | Hoechst 33258 analog 5 is an analog of Hoechst stains which are part of a family of blue fluorescent dyes used to stain DNA. |
Storage | -20°C |
Note | For research use only |
Expiration Date | 12 months from date of receipt. |
98% | |
23491-54-5 | |
422.52 | |
C26H26N6 |
98% | |
23554-98-5 | |
422.52 | |
C26H26N6 |