You have no items in your shopping cart.
Cart summary
Roburic acid
Catalog Number: orb1303613
| Catalog Number | orb1303613 |
|---|---|
| Category | Small Molecules |
| Description | Roburic acid |
| CAS Number | 6812-81-3 |
| Purity | 99.88% |
| MW | 440.7 |
| SMILES | C[C@@H]1CC[C@]2(C)CC[C@]3(C)C(=CC[C@@H]4[C@@](C)(CCC(O)=O)[C@@H](CC[C@@]34C)C(C)=C)[C@@H]2[C@H]1C |
| Formula | C30H48O2 |
| Biological Activity | Roburic acid and phenethyl-trans-ferulate inhibit COX-1 and COX-2. |
| Storage | -20°C |
| Note | For research use only |
| Expiration Date | 12 months from date of receipt. |
