You have no items in your shopping cart.
Cart summary
PPAR agonist 1
Catalog Number: orb1710283
| Catalog Number | orb1710283 |
|---|---|
| Category | Small Molecules |
| Description | PPAR agonist 1 |
| Purity | 98.00% |
| MW | 407.48 |
| Biological Activity | PPAR agonist 1 is an agonist of PPAR α/γ, used for reducing blood glucose, lipid levels, reducing body weight, and lowering cholesterol. |
| CAS Number | 539813-69-9 |
| Formula | C20H25NO6S |
| SMILES | CO[C@@H](Cc1ccc(NCCCc2ccc(OS(C)(=O)=O)cc2)cc1)C(O)=O |
| Storage | -20°C |
| Note | For research use only |
