You have no items in your shopping cart.
Cart summary
β-Ionone acid
Catalog Number: orb2814124
| Catalog Number | orb2814124 |
|---|---|
| Category | Small Molecules |
| Description | β-Ionone acid is an analog of β-Ionone, exhibiting potential anticancer properties. |
| CAS Number | 14393-45-4 |
| MW | 194.27 |
| SMILES | C(=C/C(O)=O)\C=1C(C)(C)CCCC1C |
| Formula | C12H18O2 |
| Storage | -20°C |
| Note | For research use only |
| Expiration Date | 12 months from date of receipt. |
