You have no items in your shopping cart.
Cart summary
Dihydroflavokawin B
Catalog Number: orb2279445
| Catalog Number | orb2279445 |
|---|---|
| Category | Small Molecules |
| Description | Dihydroflavokawin B is a natural product that can be used as a reference standard. The CAS number of Dihydroflavokawin B is 3791-76-2. |
| CAS Number | 3791-76-2 |
| Purity | 98.00% |
| MW | 286.327 |
| SMILES | COc1cc(O)c(C(=O)CCc2ccccc2)c(OC)c1 |
| Formula | C17H18O4 |
| Storage | -20°C |
| Note | For research use only |
| Expiration Date | 12 months from date of receipt. |
