You have no items in your shopping cart.
You have no items in your shopping cart.
Catalog Number | orb1303950 |
---|---|
Category | Small Molecules |
Description | Dcimc chloride |
Purity | 98.71% |
MW | 290.53 |
Biological Activity | Dcimc chloride (3-(2,6-Dichlorophenyl)-5-methylisoxazole-4-carbonyl chloride) has antibiotics activity. |
CAS Number | 4462-55-9 |
Formula | C11H6Cl3NO2 |
SMILES | CC1=C(C(Cl)=O)C(=NO1)C1=C(Cl)C=CC=C1Cl |
Storage | -20°C |
Note | For research use only |